Difference between revisions of "RXN-16637"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == * smiles: ** CN(C1(C=CC=CC=1))C * inchi key: ** InChI...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16637 RXN-16637] == * direction: ** LEFT-TO-RIGHT * common name: ** peptidyl-trna_hydrolase * e...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16637 RXN-16637] ==
−
* smiles:
+
* direction:
−
** CN(C1(C=CC=CC=1))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** N,N-dimethylaniline
+
** peptidyl-trna_hydrolase
−
* molecular weight:
+
* ec number:
−
** 121.182   
+
** [http://enzyme.expasy.org/EC/3.1.1.29 EC-3.1.1.29]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[1.14.13.8-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[Charged-CYS-tRNAs]][c] '''=>''' 1 [[CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CYS-tRNAs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 an L-cysteinyl-[tRNAcys][c] '''=>''' 1 L-cysteine[c] '''+''' 1 H+[c] '''+''' 1 a tRNAcys[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7443]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14300]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13800]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6308]], L-cysteine biosynthesis II (tRNA-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6308 PWY-6308]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=7195 7195]
+
{{#set: common name=peptidyl-trna_hydrolase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.1.1.29}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=949 949]
+
{{#set: gene associated=Tiso_gene_7443|Tiso_gene_14300|Tiso_gene_13800}}
−
* HMDB : HMDB01020
+
{{#set: in pathway=PWY-6308}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02846 C02846]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.924.html 924]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16269 16269]
+
−
{{#set: smiles=CN(C1(C=CC=CC=1))C}}
+
−
{{#set: inchi key=InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N}}
+
−
{{#set: common name=N,N-dimethylaniline}}
+
−
{{#set: molecular weight=121.182    }}
+
−
{{#set: consumed by=1.14.13.8-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Reaction RXN-16637

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • peptidyl-trna_hydrolase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 an L-cysteinyl-[tRNAcys][c] => 1 L-cysteine[c] + 1 H+[c] + 1 a tRNAcys[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6308, L-cysteine biosynthesis II (tRNA-dependent): PWY-6308
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16637&oldid=47125"