Difference between revisions of "ATDUDm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * inchi key: ** InChIKey=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDUDm ATDUDm] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dUDP phosphotransferase, mito...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDUDm ATDUDm] ==
* smiles:
+
* direction:
** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
+
** ATP:dUDP phosphotransferase, mitochondria
* molecular weight:
+
** 183.169   
+
 
* Synonym(s):
 
* Synonym(s):
** N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[3.2.2.23-RXN]]
+
** 1.0 [[ATP]][m] '''+''' 1.0 [[DUDP]][m] '''=>''' 1.0 [[DUTP]][m] '''+''' 1.0 [[ADP]][m]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[m] '''+''' 1.0 dUDP[m] '''=>''' 1.0 dUTP[m] '''+''' 1.0 ADP[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16529]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C04744 C04744]
+
{{#set: common name=ATP:dUDP phosphotransferase, mitochondria}}
* HMDB : HMDB11657
+
{{#set: gene associated=Tiso_gene_16529}}
* CHEBI:
+
{{#set: in pathway=}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28643 28643]
+
{{#set: reconstruction category=orthology}}
* PUBCHEM:
+
{{#set: reconstruction source=orthology-creinhardtii}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=127546 127546]
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)}}
+
{{#set: inchi key=InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N}}
+
{{#set: common name=2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine}}
+
{{#set: molecular weight=183.169    }}
+
{{#set: common name=N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide}}
+
{{#set: produced by=3.2.2.23-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Reaction ATDUDm

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:dUDP phosphotransferase, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[m] + 1.0 dUDP[m] => 1.0 dUTP[m] + 1.0 ADP[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links