Difference between revisions of "Tiso gene 16271"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] == * smiles: ** C[N+]1(C2(CCC1CC(O)C2)) * inchi key: ** InChIKey=CYHOMWAPJJPNM...")
(Created page with "Category:Gene == Gene Tiso_gene_16271 == * right end position: ** 1497 * transcription direction: ** NEGATIVE * left end position: ** 255 * centisome position: ** 5.697051...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] ==
+
== Gene Tiso_gene_16271 ==
−
* smiles:
+
* right end position:
−
** C[N+]1(C2(CCC1CC(O)C2))
+
** 1497
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** tropine
+
** 255
−
* molecular weight:
+
* centisome position:
−
** 142.22    
+
** 5.697051    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3PGAREARR-RXN]]
−
* [[TROPINESTERASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[TROPINE-DEHYDROGENASE-RXN]]
+
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[R04594]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[RIBAZOLEPHOSPHAT-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15509]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15510]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15511]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15512]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15513]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16788]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8770]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5114]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[SERSYN-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[COBALSYN-PWY]]
 +
* [[P341-PWY]]
 +
* [[PWY-1622]]
 +
* [[GLUCONEO-PWY]]
 +
* [[PWY-6405]]
 +
* [[PWY-6269]]
 +
* [[PWY-5509]]
 +
* [[PWY-5508]]
 +
* [[PWY66-399]]
 +
* [[PWY-1042]]
 +
* [[PWY-5723]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 +
* [[PWY-7124]]
 +
* [[PWY-6142]]
 +
* [[PWY-7003]]
 +
* [[PWY-2221]]
 +
* [[PWY-6886]]
 +
* [[PWY-7218]]
 +
* [[P122-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 120-29-6
+
{{#set: right end position=1497}}
−
* LIGAND-CPD:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00729 C00729]
+
{{#set: left end position=255}}
−
* CHEBI:
+
{{#set: centisome position=5.697051   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57554 57554]
+
{{#set: reaction associated=3PGAREARR-RXN|R04594|RIBAZOLEPHOSPHAT-RXN|RXN-15509|RXN-15510|RXN-15511|RXN-15512|RXN-15513|RXN-16788|RXN-8770|RXN0-5114}}
−
* NCI:
+
{{#set: pathway associated=SERSYN-PWY|GLYCOLYSIS|PWY-6901|P124-PWY|COBALSYN-PWY|P341-PWY|PWY-1622|GLUCONEO-PWY|PWY-6405|PWY-6269|PWY-5509|PWY-5508|PWY66-399|PWY-1042|PWY-5723|ANAGLYCOLYSIS-PWY|PWY-5484|PWY-7124|PWY-6142|PWY-7003|PWY-2221|PWY-6886|PWY-7218|P122-PWY}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=43870 43870]
+
−
{{#set: smiles=C[N+]1(C2(CCC1CC(O)C2))}}
+
−
{{#set: inchi key=InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O}}
+
−
{{#set: common name=tropine}}
+
−
{{#set: molecular weight=142.22   }}
+
−
{{#set: produced by=TROPINESTERASE-RXN}}
+
−
{{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_16271

  • right end position:
    • 1497
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 255
  • centisome position:
    • 5.697051
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16271&oldid=47330"