Difference between revisions of "CPD-10825"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4497 == * Synonym(s): == Reactions associated == * ACID-PHOSPHATASE-RXN ** pantograph-esiliculosus * RXNQT-4191 ** panto...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * common name: ** 4-methyl-3-o...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == |
+ | * smiles: | ||
+ | ** CC1(=C(OC(C1)=O)CC([O-])=O) | ||
+ | * common name: | ||
+ | ** 4-methyl-3-oxoadipate-enol-lactone | ||
+ | * inchi key: | ||
+ | ** InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 155.13 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10083]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123582 44123582] |
+ | {{#set: smiles=CC1(=C(OC(C1)=O)CC([O-])=O)}} | ||
+ | {{#set: common name=4-methyl-3-oxoadipate-enol-lactone}} | ||
+ | {{#set: inchi key=InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=155.13 }} | ||
+ | {{#set: consumed by=RXN-10083}} |
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite CPD-10825
- smiles:
- CC1(=C(OC(C1)=O)CC([O-])=O)
- common name:
- 4-methyl-3-oxoadipate-enol-lactone
- inchi key:
- InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
- molecular weight:
- 155.13
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC1(=C(OC(C1)=O)CC([O-])=O)" cannot be used as a page name in this wiki.