Difference between revisions of "CPD-10825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4497 == * Synonym(s): == Reactions associated == * ACID-PHOSPHATASE-RXN ** pantograph-esiliculosus * RXNQT-4191 ** panto...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * common name: ** 4-methyl-3-o...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_4497 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] ==
 +
* smiles:
 +
** CC1(=C(OC(C1)=O)CC([O-])=O)
 +
* common name:
 +
** 4-methyl-3-oxoadipate-enol-lactone
 +
* inchi key:
 +
** InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 155.13   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ACID-PHOSPHATASE-RXN]]
+
* [[RXN-10083]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
* [[RXNQT-4191]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-6348]]
+
* [[PWY-6907]]
+
* [[PWY-7356]]
+
* [[PWY-6908]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=ACID-PHOSPHATASE-RXN|RXNQT-4191}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6348|PWY-6907|PWY-7356|PWY-6908}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123582 44123582]
 +
{{#set: smiles=CC1(=C(OC(C1)=O)CC([O-])=O)}}
 +
{{#set: common name=4-methyl-3-oxoadipate-enol-lactone}}
 +
{{#set: inchi key=InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=155.13    }}
 +
{{#set: consumed by=RXN-10083}}

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-10825

  • smiles:
    • CC1(=C(OC(C1)=O)CC([O-])=O)
  • common name:
    • 4-methyl-3-oxoadipate-enol-lactone
  • inchi key:
    • InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
  • molecular weight:
    • 155.13
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(=C(OC(C1)=O)CC([O-])=O)" cannot be used as a page name in this wiki.