Difference between revisions of "CPD-15685"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_596 == * left end position: ** 85 * transcription direction: ** POSITIVE * right end position: ** 5474 * centisome position: ** 0.27321526...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_596 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
* left end position:
+
* smiles:
** 85
+
** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
* right end position:
+
* inchi key:
** 5474
+
** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
* centisome position:
+
* molecular weight:
** 0.27321526    
+
** 967.814    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E, 5Z, 7E-tetradecatrienoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-14796]]
***ec-number
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
***ec-number
+
* [[6PFRUCTPHOS-RXN]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-1042]]
+
* [[GLYCOLYSIS]]
+
* [[PWY-7385]]
+
* [[PWY-1861]]
+
* [[ANAGLYCOLYSIS-PWY]]
+
* [[PWY-5484]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=85}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959]
{{#set: right end position=5474}}
+
{{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: centisome position=0.27321526   }}
+
{{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}}
{{#set: reaction associated=2.7.1.90-RXN|6PFRUCTPHOS-RXN}}
+
{{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}}
{{#set: pathway associated=PWY-1042|GLYCOLYSIS|PWY-7385|PWY-1861|ANAGLYCOLYSIS-PWY|PWY-5484}}
+
{{#set: molecular weight=967.814   }}
 +
{{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}}
 +
{{#set: produced by=RXN-14796}}

Latest revision as of 20:20, 21 March 2018

Metabolite CPD-15685

  • smiles:
    • CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
  • inchi key:
    • InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
  • molecular weight:
    • 967.814
  • Synonym(s):
    • 2E, 5Z, 7E-tetradecatrienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.