Difference between revisions of "CPD-9700"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13527 == * left end position: ** 3192 * transcription direction: ** NEGATIVE * right end position: ** 5391 * centisome position: ** 51.1538...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * common na...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_13527 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] ==
−
* left end position:
+
* smiles:
−
** 3192
+
** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** hypoglycin B
−
* right end position:
+
* inchi key:
−
** 5391
+
** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
−
* centisome position:
+
* molecular weight:
−
** 51.153843    
+
** 269.277    
 
* Synonym(s):
 
* Synonym(s):
 +
** hypoglycine B
 +
** L-gamma-glutamyl-L-hypoglycin
 +
** γ-glutamyl-β-(methylenecyclopropyl)-alanine
 +
** (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ASPCARBTRANS-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-9157]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways associated ==
+
−
* [[PWY-7790]]
+
−
* [[PWY-7791]]
+
−
* [[PWY-5686]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3192}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135]
−
{{#set: right end position=5391}}
+
* HMDB : HMDB29428
−
{{#set: centisome position=51.153843   }}
+
* Wikipedia : Hypoglycin_B
−
{{#set: reaction associated=ASPCARBTRANS-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280]
 +
{{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}}
 +
{{#set: common name=hypoglycin B}}
 +
{{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}}
 +
{{#set: molecular weight=269.277   }}
 +
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}
 +
{{#set: produced by=RXN-9157}}

Latest revision as of 20:24, 21 March 2018

Metabolite CPD-9700

  • smiles:
    • C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
  • common name:
    • hypoglycin B
  • inchi key:
    • InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
  • molecular weight:
    • 269.277
  • Synonym(s):
    • hypoglycine B
    • L-gamma-glutamyl-L-hypoglycin
    • γ-glutamyl-β-(methylenecyclopropyl)-alanine
    • (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • HMDB : HMDB29428
  • Wikipedia : Hypoglycin_B
  • LIGAND-CPD:
"C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)" cannot be used as a page name in this wiki.


{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-9700&oldid=48431"