Difference between revisions of "CPD-9700"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13527 == * left end position: ** 3192 * transcription direction: ** NEGATIVE * right end position: ** 5391 * centisome position: ** 51.1538...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * common na...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) |
− | * | + | * common name: |
− | ** | + | ** hypoglycin B |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 269.277 |
* Synonym(s): | * Synonym(s): | ||
+ | ** hypoglycine B | ||
+ | ** L-gamma-glutamyl-L-hypoglycin | ||
+ | ** γ-glutamyl-β-(methylenecyclopropyl)-alanine | ||
+ | ** (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-9157]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135] |
− | {{#set: | + | * HMDB : HMDB29428 |
− | {{#set: | + | * Wikipedia : Hypoglycin_B |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280] |
+ | {{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}} | ||
+ | {{#set: common name=hypoglycin B}} | ||
+ | {{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}} | ||
+ | {{#set: molecular weight=269.277 }} | ||
+ | {{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}} | ||
+ | {{#set: produced by=RXN-9157}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD-9700
- smiles:
- C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
- common name:
- hypoglycin B
- inchi key:
- InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
- molecular weight:
- 269.277
- Synonym(s):
- hypoglycine B
- L-gamma-glutamyl-L-hypoglycin
- γ-glutamyl-β-(methylenecyclopropyl)-alanine
- (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)" cannot be used as a page name in this wiki.
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}