Difference between revisions of "RXN-17781"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * inchi key: ** InChIKey=WKZWTZT...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17781 RXN-17781] == * direction: ** LEFT-TO-RIGHT * common name: ** hydroxyacyl-coenzyme_a_dehy...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17781 RXN-17781] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit |
− | * | + | ** 3-hydroxyacyl-_dehydrogenase |
− | ** | + | ** hydroxyacyl-coenzyme_a_mitochondrial |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[CPD-19168]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-19167]][c] |
− | == | + | * With common name(s): |
+ | ** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 3-oxo-(7Z)-hexadecenoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18838]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5857]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18839]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14262]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14026]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}} | |
− | + | {{#set: common name=3-hydroxyacyl-_dehydrogenase}} | |
− | + | {{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}} | |
− | + | {{#set: ec number=EC-1.1.1.35}} | |
− | + | {{#set: gene associated=Tiso_gene_18838|Tiso_gene_5857|Tiso_gene_18839|Tiso_gene_14262|Tiso_gene_14026}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:33, 21 March 2018
Contents
Reaction RXN-17781
- direction:
- LEFT-TO-RIGHT
- common name:
- hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
- 3-hydroxyacyl-_dehydrogenase
- hydroxyacyl-coenzyme_a_mitochondrial
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA[c] => 1 H+[c] + 1 NADH[c] + 1 3-oxo-(7Z)-hexadecenoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18838
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5857
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18839
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14262
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14026
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation