Difference between revisions of "RXN-17781"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * inchi key: ** InChIKey=WKZWTZT...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17781 RXN-17781] == * direction: ** LEFT-TO-RIGHT * common name: ** hydroxyacyl-coenzyme_a_dehy...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17781 RXN-17781] ==
−
* smiles:
+
* direction:
−
** C=C(C1(CC(C(CC1)(O)C)O))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N
+
 
* common name:
 
* common name:
−
** (1R,2R,4S)-limonene-1,2-diol
+
** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
−
* molecular weight:
+
** 3-hydroxyacyl-_dehydrogenase
−
** 170.251   
+
** hydroxyacyl-coenzyme_a_mitochondrial
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
−
** (1S,2S,4R)-menth-8-ene-1,2-diol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-9413]]
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-19168]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-19167]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 3-oxo-(7Z)-hexadecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18838]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18839]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14026]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19082 C19082]
+
{{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}}
−
* CHEMSPIDER:
+
{{#set: common name=3-hydroxyacyl-_dehydrogenase}}
−
** [http://www.chemspider.com/Chemical-Structure.9392549.html 9392549]
+
{{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.1.35}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50244 50244]
+
{{#set: gene associated=Tiso_gene_18838|Tiso_gene_5857|Tiso_gene_18839|Tiso_gene_14262|Tiso_gene_14026}}
−
* PUBCHEM:
+
{{#set: in pathway=}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11217495 11217495]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C=C(C1(CC(C(CC1)(O)C)O))C}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=(1R,2R,4S)-limonene-1,2-diol}}
+
−
{{#set: molecular weight=170.251    }}
+
−
{{#set: common name=(1S,2S,4R)-menth-8-ene-1,2-diol}}
+
−
{{#set: produced by=RXN-9413}}
+

Latest revision as of 19:33, 21 March 2018

Reaction RXN-17781

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
    • 3-hydroxyacyl-_dehydrogenase
    • hydroxyacyl-coenzyme_a_mitochondrial
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA[c] => 1 H+[c] + 1 NADH[c] + 1 3-oxo-(7Z)-hexadecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17781&oldid=42338"