Difference between revisions of "CPD-634"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2929 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: annotation-in-silico_annotation *** Assignment:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_2929 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] ==
 +
* smiles:
 +
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
 +
* common name:
 +
** castasterone
 +
* inchi key:
 +
** InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N
 +
* molecular weight:
 +
** 464.684   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-in-silico_annotation]]
+
* [[RXN-779]]
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12195]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12196]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN0-5462]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
== Pathways associated ==
+
* [[PWY-7184]]
+
* [[PWY-7198]]
+
* [[PWY-6545]]
+
* [[PWY-7210]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=133534 133534]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23051 23051]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15794 C15794]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=castasterone}}
 +
{{#set: inchi key=InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N}}
 +
{{#set: molecular weight=464.684    }}
 +
{{#set: produced by=RXN-779}}

Latest revision as of 19:15, 21 March 2018

Metabolite CPD-634

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
  • common name:
    • castasterone
  • inchi key:
    • InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N
  • molecular weight:
    • 464.684
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.