Difference between revisions of "Tiso gene 18783"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * smiles: ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18783 == * right end position: ** 2530 * transcription direction: ** POSITIVE * left end position: ** 138 * centisome position: ** 4.928571...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
+
== Gene Tiso_gene_18783 ==
* smiles:
+
* right end position:
** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2530
* inchi key:
+
* transcription direction:
** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
+
** POSITIVE
* common name:
+
* left end position:
** 4-trans-3-oxo-undecenoyl-CoA
+
** 138
* molecular weight:
+
* centisome position:
** 943.749    
+
** 4.928571    
 
* Synonym(s):
 
* Synonym(s):
** 4E-3-oxo-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14793]]
+
* Reaction: [[THIOREDOXIN-REDUCT-NADPH-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[THIOREDOX-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2530}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=138}}
{{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}}
+
{{#set: centisome position=4.928571   }}
{{#set: common name=4-trans-3-oxo-undecenoyl-CoA}}
+
{{#set: reaction associated=THIOREDOXIN-REDUCT-NADPH-RXN}}
{{#set: molecular weight=943.749   }}
+
{{#set: pathway associated=THIOREDOX-PWY}}
{{#set: common name=4E-3-oxo-undecenoyl-CoA}}
+
{{#set: consumed by=RXN-14793}}
+

Latest revision as of 19:07, 21 March 2018

Gene Tiso_gene_18783

  • right end position:
    • 2530
  • transcription direction:
    • POSITIVE
  • left end position:
    • 138
  • centisome position:
    • 4.928571
  • Synonym(s):

Reactions associated

Pathways associated

External links