Difference between revisions of "CPD-8646"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-962 RXN1G-962] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis-delta17-C3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-962 RXN1G-962] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
 
* common name:
 
* common name:
−
** trans-delta2-cis-delta17-C36:2-[acyl-carrier protein] reductase
+
** 7-dehydrodesmosterol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
+
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
 +
* molecular weight:
 +
** 382.628   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-5,7,24-trien-3β-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-27]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[trans-D2-cis-D17-C36-ACPs]][c] '''=>''' 1 [[cis-delta17-C36-ACPs]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-26]]
−
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a trans-delta2-cis-delta17-C36:2-[acp][c] '''=>''' 1 a cis-delta17-C36:1-[acp][c] '''+''' 1 NAD+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10778]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans-delta2-cis-delta17-C36:2-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558]
−
{{#set: ec number=EC-1.3.1.M4}}
+
* HMDB : HMDB03896
−
{{#set: gene associated=Tiso_gene_10778}}
+
* CHEBI:
−
{{#set: in pathway=PWYG-321}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
 +
{{#set: common name=7-dehydrodesmosterol}}
 +
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
 +
{{#set: molecular weight=382.628    }}
 +
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
 +
{{#set: consumed by=RXN66-27}}
 +
{{#set: produced by=RXN66-26}}

Latest revision as of 19:18, 21 March 2018

Metabolite CPD-8646

  • smiles:
    • CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
  • common name:
    • 7-dehydrodesmosterol
  • inchi key:
    • InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
  • molecular weight:
    • 382.628
  • Synonym(s):
    • 5α-cholesta-5,7,24-trien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8646&oldid=40762"