|
|
| Line 1: |
Line 1: |
| | [[Category:Metabolite]] | | [[Category:Metabolite]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N3-methyluracil1498 16S-rRNA-N3-methyluracil1498] == |
| − | * smiles:
| + | |
| − | ** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S
| + | |
| | * common name: | | * common name: |
| − | ** parathion | + | ** an N3-methyluracil1498 in 16S rRNA |
| − | * inchi key:
| + | |
| − | ** InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N
| + | |
| − | * molecular weight:
| + | |
| − | ** 291.258
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** ethyl parathion
| |
| − | ** parthion
| |
| − | ** alkron
| |
| − | ** Paraphos
| |
| − | ** Foliclal
| |
| − | ** Fosferno
| |
| − | ** Fostox
| |
| − | ** Rhodiatox
| |
| − | ** O,O-diethyl O-p-nitrophenyl phosphorothioate
| |
| − | ** diethyl-p-nitrophenyl monothiophosphate
| |
| − | ** DNTP
| |
| − | ** Alleron
| |
| − | ** Aphamite
| |
| − | ** Etilon
| |
| − | ** Folidol
| |
| − | ** Phoskil
| |
| − | ** Parathion-E
| |
| − | ** Aqua 9-Parathion
| |
| − | ** Bladen
| |
| − | ** phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester
| |
| − | ** diethyl p-nitrophenyl thiophosphate
| |
| − | ** O,O-diethyl-O-(p-nitrophenyl)thionophosphate
| |
| − | ** diethylparathion
| |
| − | ** p-nitrophenol O-ester with O,O-diethylphosphorothioate
| |
| − | ** AATP
| |
| − | ** acc 3422
| |
| − | ** american cyanamid 3422
| |
| − | ** Aralo
| |
| − | ** bayer e-605
| |
| − | ** bladan f
| |
| − | ** corothion
| |
| − | ** corthione
| |
| − | ** danthion
| |
| − | ** ecatox
| |
| − | ** fosfive
| |
| − | ** fosova
| |
| − | ** fostern
| |
| − | ** genithion
| |
| − | ** kolphos
| |
| − | ** kypthion
| |
| − | ** lirothion
| |
| − | ** murfos
| |
| − | ** nitrostygmine
| |
| − | ** niuif-100
| |
| − | ** nourithion
| |
| − | ** oleofos 20
| |
| − | ** oleoparathion
| |
| − | ** Orthophos
| |
| − | ** panthion
| |
| − | ** Paramar
| |
| − | ** paramar 50
| |
| − | ** parathene
| |
| − | ** Parawet
| |
| − | ** pestox plus
| |
| − | ** pethion
| |
| − | ** phosphemol
| |
| − | ** phosphenol
| |
| − | ** phosphostigmine
| |
| − | ** stathion
| |
| − | ** strathion
| |
| − | ** sulfos
| |
| − | ** thiophos 3422
| |
| − | ** vapophos
| |
| − | ** diethyl para-nitrophenol thiophosphate
| |
| − | ** diethyl 4-nitrophenyl phosphorothionate
| |
| − | ** diethyl p-nitrophenyl thionophosphate
| |
| − | ** drexel parathion 8E
| |
| − | ** E 605 F
| |
| − | ** e 605 forte
| |
| − | ** ekatox
| |
| − | ** ethlon
| |
| − | ** folidol e605
| |
| − | ** folidol oil
| |
| − | ** fosfermo
| |
| − | ** fosfex
| |
| − | ** gearphos
| |
| − | ** lethalaire g-54
| |
| − | ** oleoparaphene
| |
| − | ** Paradust
| |
| − | ** rhodiasol
| |
| − | ** rhodiatrox
| |
| − | ** selephos
| |
| − | ** soprathion
| |
| − | ** super rodiatox
| |
| − | ** vitrex
| |
| − | ** penncap e
| |
| − | ** thiomex
| |
| − | ** tiofos
| |
| − | ** Viran
| |
| − | ** Durathion
| |
| − | ** Thionspray No.84
| |
| − | ** Bladan
| |
| − | ** Diethyl O-p-nitrophenyl phosphorothioate
| |
| − | ** Fosferno 50
| |
| − | ** Niran
| |
| − | ** Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)
| |
| | | | |
| | == Reaction(s) known to consume the compound == | | == Reaction(s) known to consume the compound == |
| − | * [[ARYLDIALKYL-PHOSPHATASE-RXN]]
| |
| | == Reaction(s) known to produce the compound == | | == Reaction(s) known to produce the compound == |
| | + | * [[RXN-11598]] |
| | == Reaction(s) of unknown directionality == | | == Reaction(s) of unknown directionality == |
| | == External links == | | == External links == |
| − | * CAS : 56-38-2
| + | {{#set: common name=an N3-methyluracil1498 in 16S rRNA}} |
| − | * PUBCHEM:
| + | {{#set: produced by=RXN-11598}} |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=991 991]
| + | |
| − | * HMDB : HMDB01355
| + | |
| − | * LIGAND-CPD:
| + | |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?C06604 C06604]
| + | |
| − | * CHEMSPIDER:
| + | |
| − | ** [http://www.chemspider.com/Chemical-Structure.13844817.html 13844817]
| + | |
| − | * CHEBI:
| + | |
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27928 27928]
| + | |
| − | {{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S}}
| + | |
| − | {{#set: common name=parathion}} | + | |
| − | {{#set: inchi key=InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N}}
| + | |
| − | {{#set: molecular weight=291.258 }} | + | |
| − | {{#set: common name=ethyl parathion|parthion|alkron|Paraphos|Foliclal|Fosferno|Fostox|Rhodiatox|O,O-diethyl O-p-nitrophenyl phosphorothioate|diethyl-p-nitrophenyl monothiophosphate|DNTP|Alleron|Aphamite|Etilon|Folidol|Phoskil|Parathion-E|Aqua 9-Parathion|Bladen|phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester|diethyl p-nitrophenyl thiophosphate|O,O-diethyl-O-(p-nitrophenyl)thionophosphate|diethylparathion|p-nitrophenol O-ester with O,O-diethylphosphorothioate|AATP|acc 3422|american cyanamid 3422|Aralo|bayer e-605|bladan f|corothion|corthione|danthion|ecatox|fosfive|fosova|fostern|genithion|kolphos|kypthion|lirothion|murfos|nitrostygmine|niuif-100|nourithion|oleofos 20|oleoparathion|Orthophos|panthion|Paramar|paramar 50|parathene|Parawet|pestox plus|pethion|phosphemol|phosphenol|phosphostigmine|stathion|strathion|sulfos|thiophos 3422|vapophos|diethyl para-nitrophenol thiophosphate|diethyl 4-nitrophenyl phosphorothionate|diethyl p-nitrophenyl thionophosphate|drexel parathion 8E|E 605 F|e 605 forte|ekatox|ethlon|folidol e605|folidol oil|fosfermo|fosfex|gearphos|lethalaire g-54|oleoparaphene|Paradust|rhodiasol|rhodiatrox|selephos|soprathion|super rodiatox|vitrex|penncap e|thiomex|tiofos|Viran|Durathion|Thionspray No.84|Bladan|Diethyl O-p-nitrophenyl phosphorothioate|Fosferno 50|Niran|Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)}}
| + | |
| − | {{#set: consumed by=ARYLDIALKYL-PHOSPHATASE-RXN}}
| + | |
