Difference between revisions of "RXN-17019"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17019 RXN-17019] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17019 RXN-17019] ==
−
* smiles:
+
* direction:
−
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** strictosidine
+
** 1-acylglycerol-3-phosphate_o-acyltransferase
−
* inchi key:
+
* ec number:
−
** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
−
* molecular weight:
+
−
** 531.581   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-α(S)-strictosidine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
** 1 [[CPD-18379]][c] '''+''' 1 [[CPD-10269]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-18380]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 1-myristoylglycerol 3-phosphate[c] '''+''' 1 palmitoleoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 1-myristoyl-2-palmitoleoyl phosphatidate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 20824-29-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291]
+
{{#set: ec number=EC-2.3.1.51}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_13959}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470]
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=strictosidine}}
+
−
{{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}}
+
−
{{#set: molecular weight=531.581    }}
+
−
{{#set: common name=3-α(S)-strictosidine}}
+
−
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Reaction RXN-17019

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-acylglycerol-3-phosphate_o-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 1-myristoylglycerol 3-phosphate[c] + 1 palmitoleoyl-CoA[c] => 1 coenzyme A[c] + 1 1-myristoyl-2-palmitoleoyl phosphatidate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17019&oldid=41531"