Difference between revisions of "ETHYL-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17714 CPD-17714] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ETHYL-PWY ETHYL-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17714 CPD-17714] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=ETHYL-PWY ETHYL-PWY] ==
* smiles:
+
* taxonomic range:
** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
* inchi key:
+
** InChIKey=ZUXXVUFLLSQMNG-GYBHJADLSA-K
+
 
* common name:
 
* common name:
** 4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
+
** ethylene biosynthesis I (plants)
* molecular weight:
+
** 494.375   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** ethene biosynthesis from methionine
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-16483]]
+
* [[4.4.1.14-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_8455]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[S-ADENMETSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13443]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ETHYL-RXN ETHYL-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820540 91820540]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=ETHYL-PWY ETHYL-PWY]
{{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))}}
+
{{#set: taxonomic range=TAX-3193}}
{{#set: inchi key=InChIKey=ZUXXVUFLLSQMNG-GYBHJADLSA-K}}
+
{{#set: common name=ethylene biosynthesis I (plants)}}
{{#set: common name=4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}}
+
{{#set: common name=ethene biosynthesis from methionine}}
{{#set: molecular weight=494.375    }}
+
{{#set: reaction found=2}}
{{#set: produced by=RXN-16483}}
+
{{#set: total reaction=3}}
 +
{{#set: completion rate=67.0}}

Latest revision as of 19:34, 21 March 2018

Pathway ETHYL-PWY

  • taxonomic range:
  • common name:
    • ethylene biosynthesis I (plants)
  • Synonym(s):
    • ethene biosynthesis from methionine

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links