Difference between revisions of "PWY3DJ-11470"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11470 PWY3DJ-11470] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-331...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11470 PWY3DJ-11470] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 1 | + | ** sphingosine and sphingosine-1-phosphate metabolism |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ceramide degradation |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''5''' reactions in the full pathway | |
− | * [[ | + | * [[CERAMIDASE-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
− | * [ | + | *** [[Tiso_gene_14341]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN3DJ-11230]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_105]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN3DJ-11417]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_1163]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2-HEXADECENAL-REDUCTASE-RXN 2-HEXADECENAL-REDUCTASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-25 RXN3DJ-25] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33154}} | |
− | + | {{#set: common name=sphingosine and sphingosine-1-phosphate metabolism}} | |
− | + | {{#set: common name=ceramide degradation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=60.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:36, 21 March 2018
Pathway PWY3DJ-11470
- taxonomic range:
- common name:
- sphingosine and sphingosine-1-phosphate metabolism
- Synonym(s):
- ceramide degradation
Reaction(s) found
3 reactions found over 5 reactions in the full pathway
- CERAMIDASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN3DJ-11230
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN3DJ-11417
- 1 associated gene(s):
- 1 reconstruction source(s) associated: