Difference between revisions of "CPDQT-38"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18994 == * right end position: ** 1250 * transcription direction: ** POSITIVE * left end position: ** 1124 * centisome position: ** 42.1131...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(5'-met...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == |
| − | * | + | * smiles: |
| − | ** | + | ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 3-(5'-methylthio)pentylmalate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 248.293 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-(5'-methylthio)pentylmalic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXNQT-4171]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-18204]] | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178] |
| − | {{#set: | + | {{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=3-(5'-methylthio)pentylmalate}} |
| − | {{#set: reaction associated=RXN- | + | {{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}} |
| + | {{#set: molecular weight=248.293 }} | ||
| + | {{#set: common name=3-(5'-methylthio)pentylmalic acid}} | ||
| + | {{#set: consumed by=RXNQT-4171}} | ||
| + | {{#set: reversible reaction associated=RXN-18204}} | ||
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite CPDQT-38
- smiles:
- CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-(5'-methylthio)pentylmalate
- inchi key:
- InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
- molecular weight:
- 248.293
- Synonym(s):
- 3-(5'-methylthio)pentylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
