Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == * smiles: ** C1(=C(C=C(O)C(O)=C1)C2(OC3(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3))) |
* common name: | * common name: | ||
− | ** | + | ** luteolin |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 285.232 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3',4',5,7-tetrahydroxyflavone | ||
+ | ** 5,7,3',4'-tetrahydroxyflavone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15291]] | ||
+ | * [[RXN-7651]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 491-70-3 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201972 25201972] |
− | {{#set: smiles= | + | * HMDB : HMDB05800 |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57545 57545] |
− | {{#set: molecular weight= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01514 C01514] |
+ | {{#set: smiles=C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))}} | ||
+ | {{#set: common name=luteolin}} | ||
+ | {{#set: inchi key=InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=285.232 }} | ||
+ | {{#set: common name=3',4',5,7-tetrahydroxyflavone|5,7,3',4'-tetrahydroxyflavone}} | ||
+ | {{#set: produced by=RXN-15291|RXN-7651}} |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite 5734-TETRAHYDROXYFLAVONE
- smiles:
- C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))
- common name:
- luteolin
- inchi key:
- InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M
- molecular weight:
- 285.232
- Synonym(s):
- 3',4',5,7-tetrahydroxyflavone
- 5,7,3',4'-tetrahydroxyflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))" cannot be used as a page name in this wiki.