Difference between revisions of "Tiso gene 1790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_1790 == * Synonym(s): == Reactions associated == * Reaction: 3.6.3.50-RXN ** Source: orthology-esiliculosus * Reaction: ATPASE-R...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
+
== Gene Tiso_gene_1790 ==
* smiles:
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
* inchi key:
+
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
+
* common name:
+
** gibberellin44 (open lactone form)
+
* molecular weight:
+
** 362.422   
+
 
* Synonym(s):
 
* Synonym(s):
** gibberellin A44 open lactone
 
** gibberellin A44 diacid
 
** GA44 open lactone
 
** GA44 (open lactone form)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN1F-168]]
+
* Reaction: [[3.6.3.50-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN1F-167]]
+
* Reaction: [[ATPASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170008
+
{{#set: reaction associated=3.6.3.50-RXN|ATPASE-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
+
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
+
{{#set: common name=gibberellin44 (open lactone form)}}
+
{{#set: molecular weight=362.422    }}
+
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
+
{{#set: consumed by=RXN1F-168}}
+
{{#set: produced by=RXN1F-167}}
+

Latest revision as of 19:36, 21 March 2018

Gene Tiso_gene_1790

  • Synonym(s):

Reactions associated

Pathways associated

External links