Difference between revisions of "CPD-17420"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7104 PWY-7104] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7104 PWY-7104] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
** dTDP-L-megosamine biosynthesis
+
** 6-hydroxytyphasterol
 +
* inchi key:
 +
** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
 +
* molecular weight:
 +
** 450.701   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[RXN-4241]]
** [[DTDPGLUCOSEPP-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* '''6''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13667 RXN-13667]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13659 RXN-13659]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13660 RXN-13660]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12404 RXN-12404]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12943 RXN-12943]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-15233 RXN-15233]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=dTDP-L-megosamine biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372]
{{#set: reaction found=2}}
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: reaction not found=6}}
+
{{#set: common name=6-hydroxytyphasterol}}
 +
{{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}}
 +
{{#set: molecular weight=450.701    }}
 +
{{#set: produced by=RXN-4241}}

Latest revision as of 19:36, 21 March 2018

Metabolite CPD-17420

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6-hydroxytyphasterol
  • inchi key:
    • InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
  • molecular weight:
    • 450.701
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.