Difference between revisions of "Tiso gene 14452"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Gene == Gene Tiso_gene_14452 == * right end position: ** 4969 * transcription direction: ** POSITIVE * left end position: ** 4261 * centisome position: ** 75.4426...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14452 == |
− | * | + | * right end position: |
− | ** | + | ** 4969 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4261 |
− | * | + | * centisome position: |
− | ** | + | ** 75.442635 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-15556]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * | + | == Pathways associated == |
− | * [[ | + | * [[PWY-7511]] |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4969}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4261}} | |
− | + | {{#set: centisome position=75.442635 }} | |
− | + | {{#set: reaction associated=RXN-15556}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:52, 21 March 2018
Gene Tiso_gene_14452
- right end position:
- 4969
- transcription direction:
- POSITIVE
- left end position:
- 4261
- centisome position:
- 75.442635
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation