Difference between revisions of "Tiso gene 15320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * common name: ** (2Z,4Z)-2-hyd...") |
(Created page with "Category:Gene == Gene Tiso_gene_15320 == * Synonym(s): == Reactions associated == * Reaction: RXN0-5462 ** Source: orthology-esiliculosus == Pathways associated =...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_15320 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[RXN0-5462]] |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN0-5462}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:52, 21 March 2018
Gene Tiso_gene_15320
- Synonym(s):
Reactions associated
- Reaction: RXN0-5462
- Source: orthology-esiliculosus
