Difference between revisions of "Tiso gene 3462"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] == * smiles: ** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
(Created page with "Category:Gene == Gene Tiso_gene_3462 == * right end position: ** 12757 * transcription direction: ** POSITIVE * left end position: ** 10740 * centisome position: ** 64.469...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] ==
+
== Gene Tiso_gene_3462 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 12757
−
* common name:
+
* transcription direction:
−
** 3-cis-decenoyl-CoA
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J
+
** 10740
−
* molecular weight:
+
* centisome position:
−
** 915.738    
+
** 64.46965    
 
* Synonym(s):
 
* Synonym(s):
−
** (3Z)-dec-3-enoyl-CoA
 
−
** 10:1(n-7)-CoA
 
−
** 10:1-Δ3-CoA
 
−
** (3Z)-decenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-4261]]
−
* [[RXN-17799]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=12757}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659267 90659267]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: left end position=10740}}
−
{{#set: common name=3-cis-decenoyl-CoA}}
+
{{#set: centisome position=64.46965   }}
−
{{#set: inchi key=InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J}}
+
{{#set: reaction associated=RXN0-4261}}
−
{{#set: molecular weight=915.738   }}
+
−
{{#set: common name=(3Z)-dec-3-enoyl-CoA|10:1(n-7)-CoA|10:1-Δ3-CoA|(3Z)-decenoyl-CoA}}
+
−
{{#set: produced by=RXN-17799}}
+

Latest revision as of 19:55, 21 March 2018

Gene Tiso_gene_3462

  • right end position:
    • 12757
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10740
  • centisome position:
    • 64.46965
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3462&oldid=44624"