Difference between revisions of "ALDH im4ac"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDH_im4ac ALDH_im4ac] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde dehydrogenase (N...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDH_im4ac ALDH_im4ac] ==
* smiles:
+
* direction:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** 3-dehydro-6-hydroxyteasterone
+
** aldehyde dehydrogenase (NAD+), Imidazole-4-acetate forming
* inchi key:
+
** InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
+
* molecular weight:
+
** 448.685   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-11535]]
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[NAD]][c] '''+''' 1.0 [[IMIDAZOLE_ACETALDEHYDE]][c] '''=>''' 1.0 [[4-IMIDAZOLEACETATE]][c] '''+''' 2.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 NAD+[c] '''+''' 1.0 imidazole acetaldehyde[c] '''=>''' 1.0 4-imidazoleacetate[c] '''+''' 2.0 H+[c] '''+''' 1.0 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3513]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515138 102515138]
+
{{#set: common name=aldehyde dehydrogenase (NAD+), Imidazole-4-acetate forming}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: gene associated=Tiso_gene_3513}}
{{#set: common name=3-dehydro-6-hydroxyteasterone}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=448.685    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: produced by=RXN-11535}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:57, 21 March 2018

Reaction ALDH_im4ac

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • aldehyde dehydrogenase (NAD+), Imidazole-4-acetate forming
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links