Difference between revisions of "DTDP-D-GALACTOSE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4484 == * right end position: ** 5028 * transcription direction: ** NEGATIVE * left end position: ** 452 * centisome position: ** 3.0552928...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GALACTOSE DTDP-D-GALACTOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GALACTOSE DTDP-D-GALACTOSE] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3)) |
− | * | + | * common name: |
− | ** | + | ** dTDP-α-D-galactose |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YSYKRGRSMLTJNL-OAOVJFGZSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 562.317 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[R02984]] | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200820 25200820] |
− | {{#set: | + | * HMDB : HMDB06876 |
− | {{#set: | + | * CHEBI: |
− | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15848 15848] |
− | + | * LIGAND-CPD: | |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02097 C02097] | ||
+ | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))}} | ||
+ | {{#set: common name=dTDP-α-D-galactose}} | ||
+ | {{#set: inchi key=InChIKey=YSYKRGRSMLTJNL-OAOVJFGZSA-L}} | ||
+ | {{#set: molecular weight=562.317 }} | ||
+ | {{#set: reversible reaction associated=R02984}} |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite DTDP-D-GALACTOSE
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))
- common name:
- dTDP-α-D-galactose
- inchi key:
- InChIKey=YSYKRGRSMLTJNL-OAOVJFGZSA-L
- molecular weight:
- 562.317
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))" cannot be used as a page name in this wiki.