Difference between revisions of "ACCOAtm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtm ACCOAtm] == * direction: ** REVERSIBLE * common name: ** Acetyl-CoA:CoA antiporter, mitocho...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtm ACCOAtm] ==
* smiles:
+
* direction:
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
** REVERSIBLE
 
* common name:
 
* common name:
** aldehydo-D-galacturonate
+
** Acetyl-CoA:CoA antiporter, mitochondrial
* inchi key:
+
** InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M
+
* molecular weight:
+
** 193.133   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[ACETYL-COA]][c] '''+''' 1.0 [[CO-A]][m] '''<=>''' 1.0 [[CO-A]][c] '''+''' 1.0 [[ACETYL-COA]][m]
* [[GALACTUROISOM-RXN]]
+
* With common name(s):
 +
** 1.0 acetyl-CoA[c] '''+''' 1.0 coenzyme A[m] '''<=>''' 1.0 coenzyme A[c] '''+''' 1.0 acetyl-CoA[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9173]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1593918 1593918]
+
{{#set: common name=Acetyl-CoA:CoA antiporter, mitochondrial}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_9173}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12952 12952]
+
{{#set: in pathway=}}
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=aldehydo-D-galacturonate}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=193.133    }}
+
{{#set: reversible reaction associated=GALACTUROISOM-RXN}}
+

Latest revision as of 19:58, 21 March 2018

Reaction ACCOAtm

  • direction:
    • REVERSIBLE
  • common name:
    • Acetyl-CoA:CoA antiporter, mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetyl-CoA[c] + 1.0 coenzyme A[m] <=> 1.0 coenzyme A[c] + 1.0 acetyl-CoA[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links