Difference between revisions of "CPD-718"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D17-29-C48-3-ACPs trans-D2-cis-cis-D17-29-C48-3-ACPs] == * common name: ** a t...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D17-29-C48-3-ACPs trans-D2-cis-cis-D17-29-C48-3-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] ==
 +
* smiles:
 +
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
** a trans-delta2-cis,cis-delta17,29-C48:3-[acp]
+
** 3-dehydroteasterone
 +
* inchi key:
 +
** InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
 +
* molecular weight:
 +
** 446.669   
 
* Synonym(s):
 
* Synonym(s):
 +
** dehydroteasterone
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-820]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-717]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a trans-delta2-cis,cis-delta17,29-C48:3-[acp]}}
+
* PUBCHEM:
{{#set: consumed by=RXN1G-820}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14353979 14353979]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20000 20000]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15792 C15792]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=3-dehydroteasterone}}
 +
{{#set: inchi key=InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N}}
 +
{{#set: molecular weight=446.669    }}
 +
{{#set: common name=dehydroteasterone}}
 +
{{#set: produced by=RXN-717}}

Latest revision as of 19:59, 21 March 2018

Metabolite CPD-718

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 3-dehydroteasterone
  • inchi key:
    • InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
  • molecular weight:
    • 446.669
  • Synonym(s):
    • dehydroteasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.