Difference between revisions of "CPD-2743"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15044 RXN-15044] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * common name: ** nicotin...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15044 RXN-15044] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/2.3.1.42 EC-2.3.1.42]
+
** nicotine-1'-N-oxide
 +
* inchi key:
 +
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
 +
* molecular weight:
 +
** 178.233   
 
* Synonym(s):
 
* Synonym(s):
 +
** nicotine N'-oxide
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[OLEOYL-COA]][c] '''=>''' 1 [[CPD-15924]][c] '''+''' 1 [[CO-A]][c]
+
* [[RXN66-81]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 glycerone phosphate[c] '''+''' 1 oleoyl-CoA[c] '''=>''' 1 1-oleoyl-2-lyso-glycerone phosphate[c] '''+''' 1 coenzyme A[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7411]], phosphatidate biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7411 PWY-7411]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-2.3.1.42}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
{{#set: in pathway=PWY-7411}}
+
* CHEMSPIDER:
{{#set: reconstruction category=annotation}}
+
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
* HMDB : HMDB01497
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
 +
{{#set: common name=nicotine-1'-N-oxide}}
 +
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
 +
{{#set: molecular weight=178.233    }}
 +
{{#set: common name=nicotine N'-oxide}}
 +
{{#set: produced by=RXN66-81}}

Latest revision as of 20:00, 21 March 2018

Metabolite CPD-2743

  • smiles:
    • C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
  • common name:
    • nicotine-1'-N-oxide
  • inchi key:
    • InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
  • molecular weight:
    • 178.233
  • Synonym(s):
    • nicotine N'-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • CHEMSPIDER:
  • HMDB : HMDB01497
"C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.