Difference between revisions of "NAPHTHOATE-SYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * common name: ** 2'-hydro...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAPHTHOATE-SYN-RXN NAPHTHOATE-SYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enz...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAPHTHOATE-SYN-RXN NAPHTHOATE-SYN-RXN] ==
−
* smiles:
+
* direction:
−
** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** 2'-hydroxynicotine
+
** [http://enzyme.expasy.org/EC/4.1.3.36 EC-4.1.3.36]
−
* inchi key:
+
−
** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
+
−
* molecular weight:
+
−
** 179.241   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-146]]
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD-6972]][c] '''=>''' 1 [[CPD-9925]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA[c] '''=>''' 1 1,4-dihydroxy-2-naphthoyl-CoA[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14257]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_19690]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_16145]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
* [[PWY-5837]], 1,4-dihydroxy-2-naphthoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5837 PWY-5837]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26562 26562]
−
* HMDB : HMDB01329
+
* LIGAND-RXN:
−
{{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07263 R07263]
−
{{#set: common name=2'-hydroxynicotine}}
+
* UNIPROT:
−
{{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}}
+
** [http://www.uniprot.org/uniprot/Q9CHK2 Q9CHK2]
−
{{#set: molecular weight=179.241    }}
+
** [http://www.uniprot.org/uniprot/P44960 P44960]
−
{{#set: produced by=RXN66-146}}
+
** [http://www.uniprot.org/uniprot/P0ABU0 P0ABU0]
 +
** [http://www.uniprot.org/uniprot/P23966 P23966]
 +
** [http://www.uniprot.org/uniprot/Q59464 Q59464]
 +
** [http://www.uniprot.org/uniprot/P73495 P73495]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: ec number=EC-4.1.3.36}}
 +
{{#set: gene associated=Tiso_gene_14257|Tiso_gene_19690|Tiso_gene_16145}}
 +
{{#set: in pathway=PWY-5837}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-athaliana|orthology-synechocystis}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:00, 21 March 2018

Reaction NAPHTHOATE-SYN-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA[c] => 1 1,4-dihydroxy-2-naphthoyl-CoA[c] + 1 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5837, 1,4-dihydroxy-2-naphthoate biosynthesis: PWY-5837
    • 4 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=NAPHTHOATE-SYN-RXN&oldid=45165"