Difference between revisions of "NAPHTHOATE-SYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * common name: ** 2'-hydro...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAPHTHOATE-SYN-RXN NAPHTHOATE-SYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enz...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAPHTHOATE-SYN-RXN NAPHTHOATE-SYN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/4.1.3.36 EC-4.1.3.36] | |
− | + | ||
− | + | ||
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[CPD-6972]][c] '''=>''' 1 [[CPD-9925]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H+[c] '''+''' 1 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA[c] '''=>''' 1 1,4-dihydroxy-2-naphthoyl-CoA[c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14257]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_19690]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Gene: [[Tiso_gene_16145]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5837]], 1,4-dihydroxy-2-naphthoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5837 PWY-5837] | ||
+ | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26562 26562] |
− | * | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07263 R07263] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CHK2 Q9CHK2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P44960 P44960] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0ABU0 P0ABU0] |
+ | ** [http://www.uniprot.org/uniprot/P23966 P23966] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59464 Q59464] | ||
+ | ** [http://www.uniprot.org/uniprot/P73495 P73495] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-4.1.3.36}} | ||
+ | {{#set: gene associated=Tiso_gene_14257|Tiso_gene_19690|Tiso_gene_16145}} | ||
+ | {{#set: in pathway=PWY-5837}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-athaliana|orthology-synechocystis}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 21:00, 21 March 2018
Contents
Reaction NAPHTHOATE-SYN-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H+[c] + 1 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA[c] => 1 1,4-dihydroxy-2-naphthoyl-CoA[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14257
- Source: orthology-athaliana
- Gene: Tiso_gene_19690
- Source: orthology-synechocystis
- Gene: Tiso_gene_16145
- Source: orthology-synechocystis
Pathways
- PWY-5837, 1,4-dihydroxy-2-naphthoate biosynthesis: PWY-5837
- 4 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-athaliana
External links