Difference between revisions of "CPD-13172"

Latest revision as of 20:00, 21 March 2018

"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-ubiquitinyl-proteins N-terminal-ubiquitinyl-proteins] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
+* smiles:
+** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
 * common name:
-** an N-terminal-monoubiquitinyl-[protein]
+** 6-hydroxy-2-cyclohexen-one-carboxylate
+* inchi key:
+** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
+* molecular weight:
+** 155.13
 * Synonym(s):
+** 6-hydroxy-2-cyclohexen-one-carboxylic acid
+** HCC
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-15564]]
+* [[RXN-12252]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=an N-terminal-monoubiquitinyl-[protein]}}
+* PUBCHEM:
-{{#set: produced by=RXN-15564}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
+{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
+{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
+{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
+{{#set: molecular weight=155.13    }}
+{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
+{{#set: produced by=RXN-12252}}