Difference between revisions of "CPD-6947"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17244 == * left end position: ** 2440 * transcription direction: ** POSITIVE * right end position: ** 3425 * centisome position: ** 63.6909...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] == * smiles: ** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C |
| − | * | + | * common name: |
| − | ** | + | ** demethylphylloquinone |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 436.676 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-phytyl-1,4-naphtoquinone | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[R06859]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[R06858]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927684 56927684] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10128305.html 10128305] |
| − | {{#set: | + | * HMDB : HMDB04649 |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31087 31087] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C13309 C13309] | ||
| + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C}} | ||
| + | {{#set: common name=demethylphylloquinone}} | ||
| + | {{#set: inchi key=InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N}} | ||
| + | {{#set: molecular weight=436.676 }} | ||
| + | {{#set: common name=2-phytyl-1,4-naphtoquinone}} | ||
| + | {{#set: consumed by=R06859}} | ||
| + | {{#set: produced by=R06858}} | ||
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite CPD-6947
- smiles:
- CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C
- common name:
- demethylphylloquinone
- inchi key:
- InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N
- molecular weight:
- 436.676
- Synonym(s):
- 2-phytyl-1,4-naphtoquinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
