Difference between revisions of "3-OXOPIMELOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * common name: ** (R)-citramalate * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == |
* smiles: | * smiles: | ||
− | ** CC(O)(C(=O)[O-]) | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
− | ** | + | ** 3-oxopimeloyl-CoA |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 918.632 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-oxopimelyl-CoA |
− | ** | + | ** 3-ketopimeloyl-CoA |
− | + | ** 3-ketopimelyl-CoA | |
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-8032]] | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266579 45266579] |
− | * | + | * HMDB : HMDB12158 |
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57350 57350] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06715 C06715] |
− | {{#set: smiles=CC(O)(C(=O)[O-]) | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: common name= | + | {{#set: common name=3-oxopimeloyl-CoA}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=918.632 }} |
− | {{#set: common name= | + | {{#set: common name=3-oxopimelyl-CoA|3-ketopimeloyl-CoA|3-ketopimelyl-CoA}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-8032}} |
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite 3-OXOPIMELOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxopimeloyl-CoA
- inchi key:
- InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I
- molecular weight:
- 918.632
- Synonym(s):
- 3-oxopimelyl-CoA
- 3-ketopimeloyl-CoA
- 3-ketopimelyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.