Difference between revisions of "CPD-11740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * common name: ** L-malic semialdeh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * common name: ** ca...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == |
* smiles: | * smiles: | ||
− | ** C(C(=O)[O-])C(O) | + | ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] |
* common name: | * common name: | ||
− | ** | + | ** carboxyphosphinopyruvate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 193.029 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10828]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10827]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707] |
− | {{#set: smiles=C(C(=O)[O-])C(O) | + | {{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}} |
− | {{#set: common name= | + | {{#set: common name=carboxyphosphinopyruvate}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=193.029 }} |
− | {{#set: | + | {{#set: consumed by=RXN-10828}} |
− | {{#set: | + | {{#set: produced by=RXN-10827}} |
Latest revision as of 21:08, 21 March 2018
Contents
Metabolite CPD-11740
- smiles:
- C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
- common name:
- carboxyphosphinopyruvate
- inchi key:
- InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
- molecular weight:
- 193.029
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.