Difference between revisions of "SIROHYDROCHLORIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17388 CPD-17388] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * smiles: ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5))) |
* common name: | * common name: | ||
| − | ** | + | ** sirohydrochlorin |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 854.779 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Precorrin |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIMETHUROPORDEHYDROG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 65207-12-7 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245154 25245154] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58351 58351] |
| − | {{#set: smiles= | + | * BIGG : scl |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05778 C05778] |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))}} |
| − | {{#set: common name= | + | {{#set: common name=sirohydrochlorin}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F}} |
| − | + | {{#set: molecular weight=854.779 }} | |
| + | {{#set: common name=Precorrin}} | ||
| + | {{#set: produced by=DIMETHUROPORDEHYDROG-RXN}} | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite SIROHYDROCHLORIN
- smiles:
- CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))
- common name:
- sirohydrochlorin
- inchi key:
- InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F
- molecular weight:
- 854.779
- Synonym(s):
- Precorrin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))" cannot be used as a page name in this wiki.
