Difference between revisions of "RXN-17487"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * common name: ** &a...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17487 RXN-17487] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17487 RXN-17487] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.99 EC-1.3.99] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * | + | * With identifiers: |
| − | * [[ | + | ** 1 [[Acceptor]][c] '''+''' 1 [[DIVINYL-PROTOCHLOROPHYLLIDE-A]][c] '''<=>''' 1 [[CPD-10337]][c] '''+''' 1 [[Donor-H2]][c] |
| − | + | * With common name(s): | |
| − | + | ** 1 an oxidized electron acceptor[c] '''+''' 1 3,8-divinyl protochlorophyllide a[c] '''<=>''' 1 chlorophyll c2[c] '''+''' 1 a reduced electron acceptor[c] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | == Pathways == | |
| − | + | == Reconstruction information == | |
| − | + | * Category: [[gap-filling]] | |
| − | + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | |
| − | + | *** Tool: [[meneco]] | |
| − | * [ | + | **** Comment: [[added for gapfilling]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-1.3.99}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
| − | + | {{#set: reconstruction tool=meneco}} | |
| − | + | {{#set: reconstruction comment=added for gapfilling}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:13, 21 March 2018
Contents
Reaction RXN-17487
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Acceptor[c] + 1 DIVINYL-PROTOCHLOROPHYLLIDE-A[c] <=> 1 CPD-10337[c] + 1 Donor-H2[c]
- With common name(s):
- 1 an oxidized electron acceptor[c] + 1 3,8-divinyl protochlorophyllide a[c] <=> 1 chlorophyll c2[c] + 1 a reduced electron acceptor[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
