Difference between revisions of "TRANS-RXN-261"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * common na...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-261 TRANS-RXN-261] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula ==...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-261 TRANS-RXN-261] ==
* smiles:
+
* direction:
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
** LEFT-TO-RIGHT
* common name:
+
** queuine
+
* inchi key:
+
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
* molecular weight:
+
** 278.29   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 
** base Q
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[GLT]][e] '''+''' 1 [[4-AMINO-BUTYRATE]][c] '''=>''' 1 [[4-AMINO-BUTYRATE]][e] '''+''' 1 [[GLT]][c]
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
* With common name(s):
 +
** 1 L-glutamate[e] '''+''' 1 4-aminobutanoate[c] '''=>''' 1 4-aminobutanoate[e] '''+''' 1 L-glutamate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10958]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
{{#set: gene associated=Tiso_gene_10958}}
* CHEBI:
+
{{#set: in pathway=}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
{{#set: reconstruction category=orthology}}
* HMDB : HMDB01495
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=queuine}}
+
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
{{#set: molecular weight=278.29    }}
+
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}}
+
{{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Reaction TRANS-RXN-261

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-glutamate[e] + 1 4-aminobutanoate[c] => 1 4-aminobutanoate[e] + 1 L-glutamate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links