Difference between revisions of "4-CYTIDINE-5-DIPHOSPHO-2-C"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == * smiles: ** CC(O)(CO)C(O)COP(OP([O-]...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == |
* smiles: | * smiles: | ||
− | ** CC( | + | ** CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 519.295 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** CDP-ME |
− | ** | + | ** CDP-methyl-D-erythritol |
− | ** | + | ** 4-diphosphocytidyl-2C-methyl-D-erythritol |
+ | ** 4-diphosphocytidyl-2-C-methylerythritol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.1.148-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.7.60-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24970669 24970669] |
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57823 57823] |
+ | * BIGG : 4c2me | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11435 C11435] |
− | {{#set: smiles=CC( | + | {{#set: smiles=CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}} |
− | {{#set: common name= | + | {{#set: common name=4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=519.295 }} |
− | {{#set: common name= | + | {{#set: common name=CDP-ME|CDP-methyl-D-erythritol|4-diphosphocytidyl-2C-methyl-D-erythritol|4-diphosphocytidyl-2-C-methylerythritol}} |
− | {{#set: consumed by=RXN | + | {{#set: consumed by=2.7.1.148-RXN}} |
− | {{#set: produced by= | + | {{#set: produced by=2.7.7.60-RXN}} |
− | + |
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C
- smiles:
- CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
- common name:
- 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
- inchi key:
- InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L
- molecular weight:
- 519.295
- Synonym(s):
- CDP-ME
- CDP-methyl-D-erythritol
- 4-diphosphocytidyl-2C-methyl-D-erythritol
- 4-diphosphocytidyl-2-C-methylerythritol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O" cannot be used as a page name in this wiki.