Difference between revisions of "Dodecanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-]...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == * common name: ** a dodecanoyl-[acp] * Synonym(s): ** a dod...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] ==
* smiles:
+
** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
+
* inchi key:
+
** InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F
+
 
* common name:
 
* common name:
** D-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** a dodecanoyl-[acp]
* molecular weight:
+
** 492.013   
+
 
* Synonym(s):
 
* Synonym(s):
** Ins(1,3,4,5)P4
+
** a dodecanoyl-[acyl-carrier protein]
** inositol (1,3,4,5)-tetrakisphosphate
+
** a lauryl-[acp]
** 1D-myo-inositol (1,3,4,5)-tetrakisphosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8730]]
+
* [[RXN-9535]]
* [[3.1.3.62-RXN]]
+
* [[RXN-9653]]
 +
* [[3.1.2.21-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.139-RXN]]
+
* [[RXN-9534]]
* [[2.7.1.127-RXN]]
+
* [[RXN-9661]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a dodecanoyl-[acp]}}
** [http://www.genome.jp/dbget-bin/www_bget?C01272 C01272]
+
{{#set: common name=a dodecanoyl-[acyl-carrier protein]|a lauryl-[acp]}}
* CHEBI:
+
{{#set: consumed by=RXN-9535|RXN-9653|3.1.2.21-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57895 57895]
+
{{#set: produced by=RXN-9534|RXN-9661}}
* METABOLIGHTS : MTBLC57895
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24742076 24742076]
+
* HMDB : HMDB01059
+
{{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}}
+
{{#set: inchi key=InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F}}
+
{{#set: common name=D-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: molecular weight=492.013    }}
+
{{#set: common name=Ins(1,3,4,5)P4|inositol (1,3,4,5)-tetrakisphosphate|1D-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: consumed by=RXN-8730|3.1.3.62-RXN}}
+
{{#set: produced by=2.7.1.139-RXN|2.7.1.127-RXN}}
+

Latest revision as of 19:07, 21 March 2018

Metabolite Dodecanoyl-ACPs

  • common name:
    • a dodecanoyl-[acp]
  • Synonym(s):
    • a dodecanoyl-[acyl-carrier protein]
    • a lauryl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a dodecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a dodecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a lauryl-[acp" cannot be used as a page name in this wiki.