Difference between revisions of "METHACRYLYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2Fe-2S-proteins 2Fe-2S-proteins] == * common name: ** an [2Fe-2S] cluster protein * Synonym(s):...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2Fe-2S-proteins 2Fe-2S-proteins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
 +
* smiles:
 +
** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
 
* common name:
 
* common name:
** an [2Fe-2S] cluster protein
+
** methylacrylyl-CoA
 +
* inchi key:
 +
** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
 +
* molecular weight:
 +
** 831.577   
 
* Synonym(s):
 
* Synonym(s):
** a holo-[2Fe-2S] cluster protein
+
** methacrylyl-CoA
 +
** 2-methylprop-2-enoyl-CoA
 +
** methacrylyl-coenzyme A
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14390]]
+
* [[MEPROPCOA-FAD-RXN]]
 +
* [[MCDH]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an [2Fe-2S] cluster protein}}
+
* CAS : 6008-91-9
{{#set: common name=a holo-[2Fe-2S] cluster protein}}
+
* PUBCHEM:
{{#set: produced by=RXN-14390}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325]
 +
* HMDB : HMDB01011
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460]
 +
{{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
 +
{{#set: common name=methylacrylyl-CoA}}
 +
{{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}}
 +
{{#set: molecular weight=831.577    }}
 +
{{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}}
 +
{{#set: produced by=MEPROPCOA-FAD-RXN|MCDH}}
 +
{{#set: reversible reaction associated=METHYLACYLYLCOA-HYDROXY-RXN}}

Latest revision as of 19:43, 21 March 2018

Metabolite METHACRYLYL-COA

  • smiles:
    • C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
  • common name:
    • methylacrylyl-CoA
  • inchi key:
    • InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
  • molecular weight:
    • 831.577
  • Synonym(s):
    • methacrylyl-CoA
    • 2-methylprop-2-enoyl-CoA
    • methacrylyl-coenzyme A

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C" cannot be used as a page name in this wiki.