Difference between revisions of "HISTIDINOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkylated-Bases Alkylated-Bases] == * common name: ** an alkylated nucleobase * Synonym(s): **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * common name: ** histidinol * inc...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == |
+ | * smiles: | ||
+ | ** C1(NC=NC=1CC(CO)[N+]) | ||
* common name: | * common name: | ||
− | ** | + | ** histidinol |
+ | * inchi key: | ||
+ | ** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O | ||
+ | * molecular weight: | ||
+ | ** 142.18 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** histidol |
+ | ** L-histidinol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8001]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HISTIDPHOS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HISTOLDEHYD-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 501-28-0 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298] |
+ | * KNAPSACK : C00007479 | ||
+ | * HMDB : HMDB03431 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699] | ||
+ | * BIGG : histd | ||
+ | {{#set: smiles=C1(NC=NC=1CC(CO)[N+])}} | ||
+ | {{#set: common name=histidinol}} | ||
+ | {{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}} | ||
+ | {{#set: molecular weight=142.18 }} | ||
+ | {{#set: common name=histidol|L-histidinol}} | ||
+ | {{#set: consumed by=RXN-8001}} | ||
+ | {{#set: produced by=HISTIDPHOS-RXN}} | ||
+ | {{#set: reversible reaction associated=HISTOLDEHYD-RXN}} |
Latest revision as of 20:43, 21 March 2018
Contents
Metabolite HISTIDINOL
- smiles:
- C1(NC=NC=1CC(CO)[N+])
- common name:
- histidinol
- inchi key:
- InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
- molecular weight:
- 142.18
- Synonym(s):
- histidol
- L-histidinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 501-28-0
- PUBCHEM:
- KNAPSACK : C00007479
- HMDB : HMDB03431
- LIGAND-CPD:
- CHEBI:
- BIGG : histd
"C1(NC=NC=1CC(CO)[N+])" cannot be used as a page name in this wiki.