Difference between revisions of "RXN-13300"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13300 RXN-13300] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13300 RXN-13300] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** chloroplast_beta-keto_acyl_reductase |
− | * | + | * ec number: |
− | ** 330. | + | ** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[CPD-14273]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-14277]][c] '''+''' 1 [[NADP]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 3-oxo-lignoceroyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 (3R)-3-hydroxy-lignoceroyl-CoA[c] '''+''' 1 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9871]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] | ||
+ | ** '''16''' reactions found over '''16''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=chloroplast_beta-keto_acyl_reductase}} | |
− | {{#set: | + | {{#set: ec number=EC-1.1.1.330}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_9871}} |
− | {{#set: | + | {{#set: in pathway=PWY-7036}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:08, 21 March 2018
Contents
Reaction RXN-13300
- direction:
- LEFT-TO-RIGHT
- common name:
- chloroplast_beta-keto_acyl_reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 3-oxo-lignoceroyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 (3R)-3-hydroxy-lignoceroyl-CoA[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9871
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
- 16 reactions found over 16 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation