Difference between revisions of "Tiso gene 20565"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * inchi key: ** InChIKey=MY...") |
(Created page with "Category:Gene == Gene Tiso_gene_20565 == * Synonym(s): == Reactions associated == * Reaction: LYSOPHOSPHOLIPASE-RXN ** Source: orthology-esiliculosus * Reaction:...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_20565 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[LYSOPHOSPHOLIPASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN-14899]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-15035]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7409]] | ||
+ | * [[PWY-7367]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-14899|RXN-15035}} | |
− | + | {{#set: pathway associated=PWY-7409|PWY-7367}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:47, 21 March 2018
Gene Tiso_gene_20565
- Synonym(s):
Reactions associated
- Reaction: LYSOPHOSPHOLIPASE-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-14899
- Source: orthology-esiliculosus
- Reaction: RXN-15035
- Source: orthology-esiliculosus