Difference between revisions of "Tiso gene 20565"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * inchi key: ** InChIKey=MY...")
 
(Created page with "Category:Gene == Gene Tiso_gene_20565 == * Synonym(s): == Reactions associated == * Reaction: LYSOPHOSPHOLIPASE-RXN ** Source: orthology-esiliculosus * Reaction:...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] ==
+
== Gene Tiso_gene_20565 ==
* smiles:
+
** C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
+
* inchi key:
+
** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
+
* common name:
+
** 7,8-dihydrolumazine
+
* molecular weight:
+
** 166.139   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
* [[RXN-15261]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14899]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15035]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 +
* [[PWY-7367]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-14899|RXN-15035}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555]
+
{{#set: pathway associated=PWY-7409|PWY-7367}}
{{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}}
+
{{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}}
+
{{#set: common name=7,8-dihydrolumazine}}
+
{{#set: molecular weight=166.139    }}
+
{{#set: produced by=RXN-15261}}
+

Latest revision as of 19:47, 21 March 2018

Gene Tiso_gene_20565

  • Synonym(s):

Reactions associated

Pathways associated

External links