Difference between revisions of "CPDQT-38"

Latest revision as of 19:48, 21 March 2018

"CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribonucleoside-Monophosphates Ribonucleoside-Monophosphates] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] ==
+* smiles:
+** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 * common name:
-** a ribonucleoside 5'-monophosphate
+** 3-(5'-methylthio)pentylmalate
+* inchi key:
+** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
+* molecular weight:
+** 248.293
 * Synonym(s):
-** a 5'-ribonucleotide
+** 3-(5'-methylthio)pentylmalic acid
 == Reaction(s) known to consume the compound ==
-* [[5-NUCLEOTID-RXN]]
+* [[RXNQT-4171]]
 == Reaction(s) known to produce the compound ==
-* [[RXN0-4222]]
 == Reaction(s) of unknown directionality ==
+* [[RXN-18204]]
 == External links  ==
-{{#set: common name=a ribonucleoside 5'-monophosphate}}
+* PUBCHEM:
-{{#set: common name=a 5'-ribonucleotide}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178]
-{{#set: consumed by=5-NUCLEOTID-RXN}}
+{{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
-{{#set: produced by=RXN0-4222}}
+{{#set: common name=3-(5'-methylthio)pentylmalate}}
+{{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}}
+{{#set: molecular weight=248.293    }}
+{{#set: common name=3-(5'-methylthio)pentylmalic acid}}
+{{#set: consumed by=RXNQT-4171}}
+{{#set: reversible reaction associated=RXN-18204}}