Difference between revisions of "ENTDB-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENTDB-RXN ENTDB-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4_-phosphopantetheinyl_tran...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENTDB-RXN ENTDB-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4_-phosphopantetheinyl_transferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[Apo-EntB]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[Holo-EntB]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 an apo-[EntB isochorismatase/aryl-carrier protein][c] '''+''' 1 coenzyme A[c] '''=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a holo-[EntB isochorismatase/aryl-carrier protein][c] '''+''' 1 H+[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14278]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[ENTBACSYN-PWY]], enterobactin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=ENTBACSYN-PWY ENTBACSYN-PWY] | ||
+ | ** '''3''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=4_-phosphopantetheinyl_transferase}} | |
− | + | {{#set: ec number=EC-2.7.8.7}} | |
− | + | {{#set: gene associated=Tiso_gene_14278}} | |
− | + | {{#set: in pathway=ENTBACSYN-PWY}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:49, 21 March 2018
Contents
Reaction ENTDB-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 4_-phosphopantetheinyl_transferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 an apo-[EntB isochorismatase/aryl-carrier protein][c] + 1 coenzyme A[c] => 1 adenosine 3',5'-bisphosphate[c] + 1 a holo-[EntB isochorismatase/aryl-carrier protein][c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14278
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- ENTBACSYN-PWY, enterobactin biosynthesis: ENTBACSYN-PWY
- 3 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation