Difference between revisions of "DERMATAN-L-IDURONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * smiles: ** CCCCCC=CCC=CCCCCCCCC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DERMATAN-L-IDURONATE DERMATAN-L-IDURONATE] == * common name: ** [dermatan]-α-L-iduronate...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DERMATAN-L-IDURONATE DERMATAN-L-IDURONATE] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** [dermatan]-α-L-iduronate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dermatan-L-iduronate |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11569]] | |
| − | * [[RXN- | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=[dermatan]-α-L-iduronate}} | |
| − | + | {{#set: common name=dermatan-L-iduronate}} | |
| − | + | {{#set: produced by=RXN-11569}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: produced by= | + | |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite DERMATAN-L-IDURONATE
- common name:
- [dermatan]-α-L-iduronate
- Synonym(s):
- dermatan-L-iduronate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"dermatan]-α-L-iduronate" cannot be used as a page name in this wiki.
