Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == * smiles: ** C1(=C(C=C(O)C(O)=C1)C2(OC3(C...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** luteolin |
+ | * inchi key: | ||
+ | ** InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 285.232 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3',4',5,7-tetrahydroxyflavone |
+ | ** 5,7,3',4'-tetrahydroxyflavone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15291]] |
− | * [[ | + | * [[RXN-7651]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 491-70-3 |
− | + | ||
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201972 25201972] |
− | * HMDB : | + | * HMDB : HMDB05800 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57545 57545] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01514 C01514] |
− | {{#set: | + | {{#set: smiles=C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))}} |
− | {{#set: | + | {{#set: common name=luteolin}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M}} |
− | {{#set: common name= | + | {{#set: molecular weight=285.232 }} |
− | + | {{#set: common name=3',4',5,7-tetrahydroxyflavone|5,7,3',4'-tetrahydroxyflavone}} | |
− | + | {{#set: produced by=RXN-15291|RXN-7651}} | |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite 5734-TETRAHYDROXYFLAVONE
- smiles:
- C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))
- common name:
- luteolin
- inchi key:
- InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M
- molecular weight:
- 285.232
- Synonym(s):
- 3',4',5,7-tetrahydroxyflavone
- 5,7,3',4'-tetrahydroxyflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))" cannot be used as a page name in this wiki.