Difference between revisions of "CPD-19158"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.21-RXN 3.1.2.21-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.21-RXN 3.1.2.21-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/3.1.2.21 EC-3.1.2.21]
+
** 3-oxo-(9Z)-hexadecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
 +
* molecular weight:
 +
** 1013.883   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-16:1-Δ9-CoA
 +
** 3-oxo-9-cis-hexadecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17791]]
** 1 [[Dodecanoyl-ACPs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DODECANOATE]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17790]]
** 1 a dodecanoyl-[acp][c] '''+''' 1 H2O[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 H+[c] '''+''' 1 laurate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
** '''31''' reactions found over '''31''' reactions in the full pathway
+
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
** '''31''' reactions found over '''31''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[gap-filling]]:
+
** [[meneco]]:
+
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.genome.jp/dbget-bin/www_bget?R04014 R04014]
+
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
{{#set: ec number=EC-3.1.2.21}}
+
{{#set: molecular weight=1013.883    }}
{{#set: in pathway=PWY-5971|PWY-5994}}
+
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
{{#set: reconstruction category=gap-filling}}
+
{{#set: consumed by=RXN-17791}}
{{#set: reconstruction tool=meneco}}
+
{{#set: produced by=RXN-17790}}
{{#set: reconstruction source=added for gapfilling}}
+

Latest revision as of 19:51, 21 March 2018

Metabolite CPD-19158

  • smiles:
    • CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(9Z)-hexadecenoyl-CoA
  • inchi key:
    • InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
  • molecular weight:
    • 1013.883
  • Synonym(s):
    • 3-oxo-16:1-Δ9-CoA
    • 3-oxo-9-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.