Difference between revisions of "GALACTUROISOM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * inchi key: ** InChIKey=JT...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTUROISOM-RXN GALACTUROISOM-RXN] == * direction: ** REVERSIBLE * common name: ** ORF ** bh0493_...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTUROISOM-RXN GALACTUROISOM-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | ** bh0493_protein |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/5.3.1.12 EC-5.3.1.12] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-15633]][c] '''<=>''' 1 [[D-TAGATURONATE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 aldehydo-D-galacturonate[c] '''<=>''' 1 D-tagaturonate[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_19097]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_8329]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7248]], pectin degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7248 PWY-7248] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[GALACTUROCAT-PWY]], D-galacturonate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GALACTUROCAT-PWY GALACTUROCAT-PWY] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27702 27702] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01983 R01983] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P0A8G3 P0A8G3] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CF53 Q9CF53] |
− | ** [http://www. | + | {{#set: direction=REVERSIBLE}} |
− | * | + | {{#set: common name=ORF}} |
− | {{#set: | + | {{#set: common name=bh0493_protein}} |
− | {{#set: | + | {{#set: ec number=EC-5.3.1.12}} |
− | {{#set: common name= | + | {{#set: gene associated=Tiso_gene_19097|Tiso_gene_8329}} |
− | {{#set: | + | {{#set: in pathway=PWY-7248|GALACTUROCAT-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:51, 21 March 2018
Contents
Reaction GALACTUROISOM-RXN
- direction:
- REVERSIBLE
- common name:
- ORF
- bh0493_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-15633[c] <=> 1 D-TAGATURONATE[c]
- With common name(s):
- 1 aldehydo-D-galacturonate[c] <=> 1 D-tagaturonate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19097
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8329
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7248, pectin degradation III: PWY-7248
- 1 reactions found over 5 reactions in the full pathway
- GALACTUROCAT-PWY, D-galacturonate degradation I: GALACTUROCAT-PWY
- 2 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links