Difference between revisions of "CPD0-2108"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-Fatty-Acyl-ACPs Saturated-Fatty-Acyl-ACPs] == * common name: ** a 2,3,4-saturated fat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == * smiles: ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-]...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == |
| + | * smiles: | ||
| + | ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-oct-2-enoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J | ||
| + | * molecular weight: | ||
| + | ** 887.685 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (2E)-octenoyl-CoA | ||
| + | ** trans-2-octenoyl-coenzyme A | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14276]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12669]] |
| − | * [[ | + | * [[ACOA80or]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14229]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05276 C05276] |
| − | {{#set: | + | * HMDB : HMDB03949 |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62242 62242] | ||
| + | * BIGG : oc2coa | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173358 46173358] | ||
| + | {{#set: smiles=CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} | ||
| + | {{#set: common name=trans-oct-2-enoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J}} | ||
| + | {{#set: molecular weight=887.685 }} | ||
| + | {{#set: common name=(2E)-octenoyl-CoA|trans-2-octenoyl-coenzyme A}} | ||
| + | {{#set: consumed by=RXN-14276}} | ||
| + | {{#set: produced by=RXN-12669|ACOA80or}} | ||
| + | {{#set: reversible reaction associated=RXN-14229}} | ||
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPD0-2108
- smiles:
- CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- common name:
- trans-oct-2-enoyl-CoA
- inchi key:
- InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
- molecular weight:
- 887.685
- Synonym(s):
- (2E)-octenoyl-CoA
- trans-2-octenoyl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.
