Difference between revisions of "CPD-2747"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14431 == * Synonym(s): == Reactions associated == * QUERCETIN-3-O-METHYLTRANSFERASE-RXN ** pantograph-athaliana * [[RXN-13935]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] == * smiles: ** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O)...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] == |
+ | * smiles: | ||
+ | ** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3)) | ||
+ | * common name: | ||
+ | ** cotinine-glucuronide | ||
+ | * inchi key: | ||
+ | ** InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N | ||
+ | * molecular weight: | ||
+ | ** 352.343 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-168]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820250 91820250] |
+ | * HMDB : HMDB01013 | ||
+ | {{#set: smiles=C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}} | ||
+ | {{#set: common name=cotinine-glucuronide}} | ||
+ | {{#set: inchi key=InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N}} | ||
+ | {{#set: molecular weight=352.343 }} | ||
+ | {{#set: produced by=RXN66-168}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CPD-2747
- smiles:
- C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
- common name:
- cotinine-glucuronide
- inchi key:
- InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N
- molecular weight:
- 352.343
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01013
"C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.