Difference between revisions of "ALCOHOL-O-ACETYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-O-ACETYLTRANSFERASE-RXN ALCOHOL-O-ACETYLTRANSFERASE-RXN] == * direction: ** REVERSIBLE * co...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-O-ACETYLTRANSFERASE-RXN ALCOHOL-O-ACETYLTRANSFERASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.84 EC-2.3.1.84] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ACETYL-COA]][c] '''+''' 1 [[Alcohols]][c] '''<=>''' 1 [[Acetic-Esters]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 acetyl-CoA[c] '''+''' 1 an alcohol[c] '''<=>''' 1 an acetic ester[c] '''+''' 1 coenzyme A[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10528]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00627 R00627] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q12304 Q12304] |
− | + | ** [http://www.uniprot.org/uniprot/P40353 P40353] | |
− | ** [http://www. | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=ORF}} |
− | {{#set: | + | {{#set: ec number=EC-2.3.1.84}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_10528}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:52, 21 March 2018
Contents
Reaction ALCOHOL-O-ACETYLTRANSFERASE-RXN
- direction:
- REVERSIBLE
- common name:
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACETYL-COA[c] + 1 Alcohols[c] <=> 1 Acetic-Esters[c] + 1 CO-A[c]
- With common name(s):
- 1 acetyl-CoA[c] + 1 an alcohol[c] <=> 1 an acetic ester[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10528
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links