Difference between revisions of "OLEATE-CPD"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42. RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NAD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * common name: ** oleate * i...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCCCCCCCC([O-])=O |
+ | * common name: | ||
+ | ** oleate | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M | ||
+ | * molecular weight: | ||
+ | ** 281.457 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** oleic acid | ||
+ | ** (9Z)-octadec-9-enoate | ||
+ | ** (9Z)-octadecenoate | ||
+ | ** (9Z)-octadecenoic acid | ||
+ | ** (9Z)-octadec-9-enoic acid | ||
+ | ** (Z)-octadec-9-enoic acid | ||
+ | ** 18:1 n-9 | ||
+ | ** 18:1Δ9cis | ||
+ | ** C18:1 n-9 | ||
+ | ** cis-9-octadecenoic acid | ||
+ | ** cis-Δ9-octadecenoic acid | ||
+ | ** cis-oleic acid | ||
+ | ** octadec-9-enoic acid | ||
+ | ** octadecenoate (n-C18:1) | ||
+ | ** 9-octadecenoic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-9644]] |
− | * | + | * [[RXN0-7239]] |
− | * | + | * [[RXN-12776]] |
− | + | * [[FACOAL18111Z]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[3.1.2.14-RXN]] | |
− | + | * [[RXN-9666]] | |
− | + | * [[RXN-15068]] | |
− | * [[ | + | * [[RXN-15088]] |
− | + | * [[RXN-15067]] | |
− | + | * [[RXN-15035]] | |
+ | * [[RXN-15089]] | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 112-80-1 |
− | {{#set: | + | * BIGG : ocdcea |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460221 5460221] |
− | {{#set: | + | * HMDB : HMDB00207 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00712 C00712] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573837.html 4573837] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30823 30823] | ||
+ | * METABOLIGHTS : MTBLC30823 | ||
+ | {{#set: smiles=CCCCCCCCC=CCCCCCCCC([O-])=O}} | ||
+ | {{#set: common name=oleate}} | ||
+ | {{#set: inchi key=InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M}} | ||
+ | {{#set: molecular weight=281.457 }} | ||
+ | {{#set: common name=oleic acid|(9Z)-octadec-9-enoate|(9Z)-octadecenoate|(9Z)-octadecenoic acid|(9Z)-octadec-9-enoic acid|(Z)-octadec-9-enoic acid|18:1 n-9|18:1Δ9cis|C18:1 n-9|cis-9-octadecenoic acid|cis-Δ9-octadecenoic acid|cis-oleic acid|octadec-9-enoic acid|octadecenoate (n-C18:1)|9-octadecenoic acid}} | ||
+ | {{#set: consumed by=RXN-9644|RXN0-7239|RXN-12776|FACOAL18111Z}} | ||
+ | {{#set: produced by=3.1.2.14-RXN|RXN-9666|RXN-15068|RXN-15088|RXN-15067|RXN-15035|RXN-15089}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite OLEATE-CPD
- smiles:
- CCCCCCCCC=CCCCCCCCC([O-])=O
- common name:
- oleate
- inchi key:
- InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M
- molecular weight:
- 281.457
- Synonym(s):
- oleic acid
- (9Z)-octadec-9-enoate
- (9Z)-octadecenoate
- (9Z)-octadecenoic acid
- (9Z)-octadec-9-enoic acid
- (Z)-octadec-9-enoic acid
- 18:1 n-9
- 18:1Δ9cis
- C18:1 n-9
- cis-9-octadecenoic acid
- cis-Δ9-octadecenoic acid
- cis-oleic acid
- octadec-9-enoic acid
- octadecenoate (n-C18:1)
- 9-octadecenoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 112-80-1
- BIGG : ocdcea
- PUBCHEM:
- HMDB : HMDB00207
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC30823
"CCCCCCCCC=CCCCCCCCC([O-])=O" cannot be used as a page name in this wiki.